CAS 33070-32-5 appears in our catalog under these names: 5-Bromo-2,2-difluorobenzodioxole 97%, 5-Bromo-2,2-difluorobenzodioxole, 97%, 5-Bromo-2,2-difluoro-1,3-benzodioxole, 5-Bromo-2,2-difluorobenzodioxole, 98%, 98%, 5-Bromo-2,2-difluoro-1,3-benzodioxole, 97% . Offered by: Ambeed, Biosynth, Chemat, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g, 1kg.
5-bromo-2,2-difluoro-1,3-benzodioxole (CAS 33070-32-5) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 5-bromo-2,2-difluoro-1,3-benzodioxole. InChIKey: SZRHWHHXVXSGMT-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 5-bromo-2,2-difluoro-1,3-benzodioxole |
| InChIKey | SZRHWHHXVXSGMT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC(O2)(F)F |
Computed by PubChem (NCBI)