cas: 1131397-73-3 — see every product listed under this CAS number, including other names
3-Chloro-5-fluorobenzene-1-sulfonyl chloride, 95+% (CAS 1131397-73-3) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A114741-10g |
| cas | 1131397-73-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19365.64 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-chloro-5-fluorobenzenesulfonyl chloride (CAS 1131397-73-3) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 3-chloro-5-fluorobenzenesulfonyl chloride. InChIKey: DMJUAPPEXOKHSW-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FO2S |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 3-chloro-5-fluorobenzenesulfonyl chloride |
| InChIKey | DMJUAPPEXOKHSW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(=O)(=O)Cl)Cl)F |
Computed by PubChem (NCBI)