CAS 942035-77-0 appears in our catalog under these names: 4-Chloro-3-fluorobenzenesulfonyl chloride, 95%, 4-Chloro-3-fluorobenzenesulfonyl chloride. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g, 25g.
4-chloro-3-fluorobenzenesulfonyl chloride (CAS 942035-77-0) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 4-chloro-3-fluorobenzenesulfonyl chloride. InChIKey: RFNFVLMVKPVCRW-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FO2S |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 4-chloro-3-fluorobenzenesulfonyl chloride |
| InChIKey | RFNFVLMVKPVCRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)F)Cl |
Computed by PubChem (NCBI)