CAS 91170-93-3 appears in our catalog under these names: 3–Chloro–4–fluorobenzenesulfonyl chloride, 3-Chloro-4-fluorobenzenesulfonyl chloride, 98% , 3-Chloro-4-fluorobenzenesulfonyl chloride, 98%, 3-Chloro-4-fluorobenzenesulfonyl Chloride, >98.0%(GC)(T), 3-Chloro-4-fluorobenzene-1-sulfonyl chloride 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Fluorochem, TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g.
3-chloro-4-fluorobenzenesulfonyl chloride (CAS 91170-93-3) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 3-chloro-4-fluorobenzenesulfonyl chloride. InChIKey: DXFXNSNBZNELII-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FO2S |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 3-chloro-4-fluorobenzenesulfonyl chloride |
| InChIKey | DXFXNSNBZNELII-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)Cl)F |
Computed by PubChem (NCBI)