Products 141337-26-0
CAS 141337-26-0 appears in our catalog under these names: 4-Chloro-2-fluorobenzenesulfonyl chloride, 97%, 4–Chloro–2–fluorobenzenesulfonyl chloride, 4-Chloro-2-fluorobenzenesulfonyl chloride 97%, 4-Chloro-2-fluorobenzenesulfonyl chloride, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 100g.
4-chloro-2-fluorobenzenesulfonyl chloride (CAS 141337-26-0) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 4-chloro-2-fluorobenzenesulfonyl chloride. InChIKey: ZFZRENUEJCOCRE-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FO2S |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 4-chloro-2-fluorobenzenesulfonyl chloride |
| InChIKey | ZFZRENUEJCOCRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Chloro-2-fluorobenzene-1-sulfonyl chloride, 4-Chloro-2-fluorobenzenesulfonyl chloride, 4-chloro-2-fluorobenzenesulphonyl chloride, Benzenesulfonyl chloride, 4-chloro-2-fluoro-, 4-chloro-2-fluoro-benzenesulfonyl Chloride, 4-Chloro-2-fluorobenzenesulfonylchloride, 2-fluoro-4-chlorobenzenesulfonyl chloride, 2-fluoro-4-chloro benzene sulfonyl chloride, 4-Chloro-2-fl, ZFZRENUEJCOCRE-UHFFFAOYSA-N