CAS 504424-79-7 appears in our catalog under these names: 2-Chloro-3-fluorobenzene-1-sulfonyl chloride, 98%, 2-Chloro-3-fluorobenzene-1-sulfonyl chloride 95%, 2-Chloro-3-fluorobenzenesulfonyl chloride, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g.
2-chloro-3-fluorobenzenesulfonyl chloride (CAS 504424-79-7) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 2-chloro-3-fluorobenzenesulfonyl chloride. InChIKey: JGUJGYPYRWDTMV-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FO2S |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2-chloro-3-fluorobenzenesulfonyl chloride |
| InChIKey | JGUJGYPYRWDTMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)Cl)Cl)F |
Computed by PubChem (NCBI)