Products 1208075-25-5
CAS 1208075-25-5 appears in our catalog under these names: 2-Chloro-6-fluorobenzene-1-sulfonyl chloride, 95%, 2-Chloro-6-fluorobenzenesulfonyl chloride, 2-Chloro-6-fluorobenzene-1-sulfonyl chloride 95%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-chloro-6-fluorobenzenesulfonyl chloride (CAS 1208075-25-5) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 2-chloro-6-fluorobenzenesulfonyl chloride. InChIKey: FJSIDPINTJZFNS-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FO2S |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2-chloro-6-fluorobenzenesulfonyl chloride |
| InChIKey | FJSIDPINTJZFNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)
Synonyms:
2-Chloro-6-fluorobenzene-1-sulfonyl chloride, 2-Chloro-6-fluorobenzenesulfonyl chloride, 2-Chloro-6-fluoro-1-benzenesulfonyl Chloride, 2-chloro-6-fluoro-benzenesulfonyl chloride, 2-Chloro-6-fluorobenzene-1-sulfonylchloride, Benzenesulfonyl chloride, 2-chloro-6-fluoro-, 2-Chloro-6-fluorophenyllbenzenesulfonyl chloride