CAS 82875-86-3 appears in our catalog under these names: 2-Chloro-5-fluorobenzene-1-sulfonyl chloride, 95%, 2-Chloro-5-fluorobenzene-1-sulfonyl chloride, 97%, 2-Chloro-5-fluorobenzene-1-sulfonyl chloride 95%, 2-Chloro-5-fluorobenzenesulfonyl chloride. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g.
2-chloro-5-fluorobenzenesulfonyl chloride (CAS 82875-86-3) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 2-chloro-5-fluorobenzenesulfonyl chloride. InChIKey: IKUKZLDGZFXXNE-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FO2S |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2-chloro-5-fluorobenzenesulfonyl chloride |
| InChIKey | IKUKZLDGZFXXNE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)