CAS 351003-48-0 appears in our catalog under these names: 3-Chloro-2-fluorobenzenesulfonyl Chloride, >98.0%(GC)(T), 3-Chloro-2-fluorobenzenesulfonyl chloride 98%, 3-Chloro-2-fluorobenzenesulfonyl chloride, 95%. Offered by: TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g, 500g.
3-chloro-2-fluorobenzenesulfonyl chloride (CAS 351003-48-0) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 3-chloro-2-fluorobenzenesulfonyl chloride. InChIKey: LIRQNYQIFFLGIE-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FO2S |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 3-chloro-2-fluorobenzenesulfonyl chloride |
| InChIKey | LIRQNYQIFFLGIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)