CAS 85958-57-2 appears in our catalog under these names: 2-Chloro-4-fluorobenzenesulfonyl chloride 97%, 2-Chloro-4-fluorobenzenesulfonyl chloride, 96%, 2-Chloro-4-fluorobenzene-1-sulfonyl chloride, 97% . Offered by: Ambeed, Fluorochem, Thermo Scientific. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
2-chloro-4-fluorobenzenesulfonyl chloride (CAS 85958-57-2) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 2-chloro-4-fluorobenzenesulfonyl chloride. InChIKey: FCFPJKHVCHKCMP-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FO2S |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2-chloro-4-fluorobenzenesulfonyl chloride |
| InChIKey | FCFPJKHVCHKCMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)