Products 60191-50-6
CAS 60191-50-6 appears in our catalog under these names: 3,4-Dichlorobenzene-1-sulfonyl fluoride 95%, 3,4-Dichlorobenzene-1-sulfonyl fluoride, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,4-dichlorobenzenesulfonyl fluoride (CAS 60191-50-6) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 3,4-dichlorobenzenesulfonyl fluoride. InChIKey: MEUGNSGWAGTVDJ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FO2S |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 3,4-dichlorobenzenesulfonyl fluoride |
| InChIKey | MEUGNSGWAGTVDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)F)Cl)Cl |
Computed by PubChem (NCBI)