Products 351003-49-1

CAS 351003-49-1 appears in our catalog under these names: 5–Chloro–2–fluorobenzenesulfonyl chloride, 5-Chloro-2-fluorobenzenesulfonyl chloride 98%, 5-Chloro-2-fluorobenzenesulfonyl chloride, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-chloro-2-fluorobenzenesulfonyl chloride (CAS 351003-49-1) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 5-chloro-2-fluorobenzenesulfonyl chloride. InChIKey: OZKAHSNNKADHTK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl2FO2S
Molecular weight229.06 g/mol
IUPAC name5-chloro-2-fluorobenzenesulfonyl chloride
InChIKeyOZKAHSNNKADHTK-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)