Products 1131397-73-3

CAS 1131397-73-3 appears in our catalog under these names: 3-Chloro-5-fluorobenzenesulfonyl chloride, 3-Chloro-5-fluorobenzene-1-sulfonyl chloride, 95%, 3-Chloro-5-fluorobenzene-1-sulfonyl chloride, 95+%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

3-chloro-5-fluorobenzenesulfonyl chloride (CAS 1131397-73-3) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 3-chloro-5-fluorobenzenesulfonyl chloride. InChIKey: DMJUAPPEXOKHSW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl2FO2S
Molecular weight229.06 g/mol
IUPAC name3-chloro-5-fluorobenzenesulfonyl chloride
InChIKeyDMJUAPPEXOKHSW-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1S(=O)(=O)Cl)Cl)F

Computed by PubChem (NCBI)