CAS 98566-97-3 is the registry number for 2,3-Dichlorobenzenesulfonyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,3-dichlorobenzenesulfonyl fluoride (CAS 98566-97-3) is a chemical compound with the molecular formula C6H3Cl2FO2S and a molecular weight of 229.06 g/mol. IUPAC name: 2,3-dichlorobenzenesulfonyl fluoride. InChIKey: FNXHXUGJBKXHFS-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2FO2S |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2,3-dichlorobenzenesulfonyl fluoride |
| InChIKey | FNXHXUGJBKXHFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)S(=O)(=O)F |
Computed by PubChem (NCBI)