cas: 21617-18-5 — see every product listed under this CAS number, including other names
4,5-Dichloroquinoline 97% (CAS 21617-18-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A108750-100mg |
| cas | 21617-18-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 2973.62 Pln | |
| Ambeed | 25g | 9937.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A108750 |
4,5-dichloroquinoline (CAS 21617-18-5) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 4,5-dichloroquinoline. InChIKey: SNZMBGPVGUVXRP-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 4,5-dichloroquinoline |
| InChIKey | SNZMBGPVGUVXRP-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CC(=C2C(=C1)Cl)Cl |
Computed by PubChem (NCBI)