cas: 1588-83-6 — see every product listed under this CAS number, including other names
4-Amino-3-nitrobenzoic Acid, >95.0%(HPLC)(T) (CAS 1588-83-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A1417-25G |
| cas | 1588-83-6 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 265.86 Pln | |
| TCI | 100g | 546.15 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(HPLC)(T) |
4-amino-3-nitrobenzoic acid (CAS 1588-83-6) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 4-amino-3-nitrobenzoic acid. InChIKey: ZZNAYFWAXZJITH-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 4-amino-3-nitrobenzoic acid |
| InChIKey | ZZNAYFWAXZJITH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])N |
Computed by PubChem (NCBI)