cas: 1588-83-6 — see every product listed under this CAS number, including other names
4-Amino-3-nitrobenzoic acid, 95% (CAS 1588-83-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076517-10G |
| cas | 1588-83-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 206.20 Pln | |
| Fluorochem | 500g | 622.72 Pln | |
| Fluorochem | 1kg | 987.17 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-amino-3-nitrobenzoic acid (CAS 1588-83-6) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 4-amino-3-nitrobenzoic acid. InChIKey: ZZNAYFWAXZJITH-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 4-amino-3-nitrobenzoic acid |
| InChIKey | ZZNAYFWAXZJITH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])N |
Computed by PubChem (NCBI)