cas: 1588-83-6 — see every product listed under this CAS number, including other names
4-Amino-3-nitrobenzoic acid 95% (CAS 1588-83-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A414128-10g |
| cas | 1588-83-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 125.62 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 854.31 Pln | |
| Ambeed | 1000g | 1377.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A414128 |
4-amino-3-nitrobenzoic acid (CAS 1588-83-6) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 4-amino-3-nitrobenzoic acid. InChIKey: ZZNAYFWAXZJITH-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 4-amino-3-nitrobenzoic acid |
| InChIKey | ZZNAYFWAXZJITH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])N |
Computed by PubChem (NCBI)