cas: 1588-83-6 — see every product listed under this CAS number, including other names
4-Amino-3-nitrobenzoic acid, 98% (CAS 1588-83-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 400880050 |
| cas | 1588-83-6 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 117.60 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
4-amino-3-nitrobenzoic acid (CAS 1588-83-6) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 4-amino-3-nitrobenzoic acid. InChIKey: ZZNAYFWAXZJITH-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 4-amino-3-nitrobenzoic acid |
| InChIKey | ZZNAYFWAXZJITH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])N |
Computed by PubChem (NCBI)