CAS 144584-66-7 appears in our catalog under these names: 4-Bromo-2,2-difluoro-1,3-benzodioxole, 97% , 4-BROMO-2,2-DIFLUORO-1,3-BENZODIOXOLE, &, 4-Bromo-2,2-difluorobenzodioxole, 97%, 97%, 4-Bromo-2,2-difluorobenzo[d][1,3]dioxole, 97%. Offered by: Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g, 100mg, 10g, 50g.
4-bromo-2,2-difluoro-1,3-benzodioxole (CAS 144584-66-7) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 4-bromo-2,2-difluoro-1,3-benzodioxole. InChIKey: LSZYHXNOLVSZHH-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 4-bromo-2,2-difluoro-1,3-benzodioxole |
| InChIKey | LSZYHXNOLVSZHH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)OC(O2)(F)F |
Computed by PubChem (NCBI)