cas: 183065-68-1 — see every product listed under this CAS number, including other names
4-Bromo-2,6-difluorobenzoic acid, 98%, 98% (CAS 183065-68-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 1kg, 5kg, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1135D7-1g |
| cas | 183065-68-1 |
| size | 1g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 141.20 Pln | |
| Chemat | 100g | 371.60 Pln | |
| Chemat | 1kg | 2829.20 Pln | |
| Chemat | 5kg | 7296.00 Pln | |
| Chemat | 500g | 1689.60 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2,6-difluorobenzoic acid (CAS 183065-68-1) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 4-bromo-2,6-difluorobenzoic acid. InChIKey: IRHPJGPQWZEZRX-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 4-bromo-2,6-difluorobenzoic acid |
| InChIKey | IRHPJGPQWZEZRX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)F)Br |
Computed by PubChem (NCBI)