cas: 117738-75-7 — see every product listed under this CAS number, including other names
4-Bromo-3,5-dichlorobenzoic acid, 98%, 98% (CAS 117738-75-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149YM-250mg |
| cas | 117738-75-7 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 237.20 Pln | |
| Chemat | 25g | 491.60 Pln | |
| Chemat | 50g | 904.40 Pln | |
| Chemat | 100g | 1715.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-3,5-dichlorobenzoic acid (CAS 117738-75-7) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 4-bromo-3,5-dichlorobenzoic acid. InChIKey: KVYHYUJRKYXVRG-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 4-bromo-3,5-dichlorobenzoic acid |
| InChIKey | KVYHYUJRKYXVRG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)Br)Cl)C(=O)O |
Computed by PubChem (NCBI)