Products 232275-51-3
CAS 232275-51-3 appears in our catalog under these names: 4-Bromo-2,6-dichlorobenzoic acid, 97%, 4–Bromo–2,6–dichlorobenzoic Acid, 4-Bromo-2,6-dichlorobenzoic Acid, >98.0%(GC)(T), 4-Bromo-2,6-dichlorobenzoic acid 97%, 4-Bromo-2,6-dichlorobenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 250mg, 500g.
4-bromo-2,6-dichlorobenzoic acid (CAS 232275-51-3) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 4-bromo-2,6-dichlorobenzoic acid. InChIKey: SSWALODYSQLVPK-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 4-bromo-2,6-dichlorobenzoic acid |
| InChIKey | SSWALODYSQLVPK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(=O)O)Cl)Br |
Computed by PubChem (NCBI)