CAS 951884-96-1 appears in our catalog under these names: 3-Bromo-2,4-dichlorobenzoic acid, 96%, 3-Bromo-2,4-dichlorobenzoic acid, 98%, 3–Bromo–2,4–dichlorobenzoic acid, 3-bromo-2,4-dichlorobenzoic acid, ≥95%, ≥95%, 3-Bromo-2,4-dichlorobenzoic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
3-bromo-2,4-dichlorobenzoic acid (CAS 951884-96-1) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 3-bromo-2,4-dichlorobenzoic acid. InChIKey: OCILIDFQDDWNEN-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 3-bromo-2,4-dichlorobenzoic acid |
| InChIKey | OCILIDFQDDWNEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)Br)Cl |
Computed by PubChem (NCBI)