Products 791137-25-2
CAS 791137-25-2 appears in our catalog under these names: 3-Bromo-4,5-dichlorobenzoic acid, 95%, 3-Bromo-4,5-dichlorobenzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-bromo-4,5-dichlorobenzoic acid (CAS 791137-25-2) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 3-bromo-4,5-dichlorobenzoic acid. InChIKey: DNBQQKJUGWWBLT-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 3-bromo-4,5-dichlorobenzoic acid |
| InChIKey | DNBQQKJUGWWBLT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)Cl)Br)C(=O)O |
Computed by PubChem (NCBI)