Products 1206969-65-4
CAS 1206969-65-4 is the registry number for 5-Bromo-3,4-dichloro-2-hydroxybenzaldehyde, 98%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
5-bromo-3,4-dichloro-2-hydroxybenzaldehyde (CAS 1206969-65-4) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 5-bromo-3,4-dichloro-2-hydroxybenzaldehyde. InChIKey: HMWSDCXXDUYDTO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 5-bromo-3,4-dichloro-2-hydroxybenzaldehyde |
| InChIKey | HMWSDCXXDUYDTO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)Cl)O)C=O |
Computed by PubChem (NCBI)