CAS 791137-20-7 appears in our catalog under these names: 5-Bromo-2,4-dichlorobenzoic acid, 95%, 5-Bromo-2,4-dichlorobenzoic acid 95+%, 5-bromo-2,4-dichlorobenzoic acid, 95%+, 95%+. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
5-bromo-2,4-dichlorobenzoic acid (CAS 791137-20-7) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 5-bromo-2,4-dichlorobenzoic acid. InChIKey: HWUOPUMSIRQTGW-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 5-bromo-2,4-dichlorobenzoic acid |
| InChIKey | HWUOPUMSIRQTGW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)