Products 80257-12-1
CAS 80257-12-1 appears in our catalog under these names: 3-bromo-2,6-dichlorobenzoic acid, 95%, 3-Bromo-2,6-dichlorobenzoic acid 98%, 2,6-Dichloro-3-bromobenzoic acid, 98%, 98%, 2,6-DICHLORO-3-BROMOBENZOIC ACID, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 500mg.
3-bromo-2,6-dichlorobenzoic acid (CAS 80257-12-1) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 3-bromo-2,6-dichlorobenzoic acid. InChIKey: UPXIKFYPSUMMSP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 3-bromo-2,6-dichlorobenzoic acid |
| InChIKey | UPXIKFYPSUMMSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)C(=O)O)Cl)Br |
Computed by PubChem (NCBI)
Synonyms:
3-Bromo-2,6-dichloro-benzoic acid