CAS 501009-14-9 appears in our catalog under these names: 5-Bromo-2,3-dichlorobenzoic acid, 98%, 5-Bromo-2,3-dichlorobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-bromo-2,3-dichlorobenzoic acid (CAS 501009-14-9) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 5-bromo-2,3-dichlorobenzoic acid. InChIKey: UEIAMAMGNCIAPZ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 5-bromo-2,3-dichlorobenzoic acid |
| InChIKey | UEIAMAMGNCIAPZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)Cl)Br |
Computed by PubChem (NCBI)