Products 1257517-66-0
CAS 1257517-66-0 appears in our catalog under these names: 4–Bromo–2，3–dichlorobenzoic acid, 4-Bromo-2,3-dichlorobenzoic acid, 4-Bromo-2,3-dichlorobenzoic acid 95%, 4-Bromo-2,3-dichlorobenzoic acid, 95%, 95%, 4-Bromo-2,3-dichlorobenzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 0,5g, 100mg, 250mg, 50mg, 500mg, 2.5g.
4-bromo-2,3-dichlorobenzoic acid (CAS 1257517-66-0) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 4-bromo-2,3-dichlorobenzoic acid. InChIKey: DLGSXLUJGRIHID-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 4-bromo-2,3-dichlorobenzoic acid |
| InChIKey | DLGSXLUJGRIHID-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)Cl)Br |
Computed by PubChem (NCBI)