CAS 885532-41-2 appears in our catalog under these names: 4–Bromo–2,5–dichlorobenzoic acid, 4-Bromo-2,5-dichlorobenzoic acid 97%, 4-Bromo-2,5-dichlorobenzoic acid, 97%, 97%, 4-Bromo-2,5-dichlorobenzoic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 10g.
4-bromo-2,5-dichlorobenzoic acid (CAS 885532-41-2) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 4-bromo-2,5-dichlorobenzoic acid. InChIKey: DVJHKDHDHAPDPH-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 4-bromo-2,5-dichlorobenzoic acid |
| InChIKey | DVJHKDHDHAPDPH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Br)Cl)C(=O)O |
Computed by PubChem (NCBI)