Products 885532-41-2

CAS 885532-41-2 appears in our catalog under these names: 4–Bromo–2,5–dichlorobenzoic acid, 4-Bromo-2,5-dichlorobenzoic acid 97%, 4-Bromo-2,5-dichlorobenzoic acid, 97%, 97%, 4-Bromo-2,5-dichlorobenzoic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

4-bromo-2,5-dichlorobenzoic acid (CAS 885532-41-2) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 4-bromo-2,5-dichlorobenzoic acid. InChIKey: DVJHKDHDHAPDPH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrCl2O2
Molecular weight269.90 g/mol
IUPAC name4-bromo-2,5-dichlorobenzoic acid
InChIKeyDVJHKDHDHAPDPH-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1Cl)Br)Cl)C(=O)O

Computed by PubChem (NCBI)