CAS 650598-43-9 appears in our catalog under these names: 2-Bromo-4,6-dichlorobenzoic acid, 95%, 2-Bromo-4,6-dichlorobenzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 250mg.
2-bromo-4,6-dichlorobenzoic acid (CAS 650598-43-9) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 2-bromo-4,6-dichlorobenzoic acid. InChIKey: TYLORTSVHWJWAD-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 2-bromo-4,6-dichlorobenzoic acid |
| InChIKey | TYLORTSVHWJWAD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(=O)O)Br)Cl |
Computed by PubChem (NCBI)