Products 650598-43-9

CAS 650598-43-9 appears in our catalog under these names: 2-Bromo-4,6-dichlorobenzoic acid, 95%, 2-Bromo-4,6-dichlorobenzoic acid, 97%, 2-Bromo-4,6-dichlorobenzoic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-bromo-4,6-dichlorobenzoic acid (CAS 650598-43-9) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 2-bromo-4,6-dichlorobenzoic acid. InChIKey: TYLORTSVHWJWAD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrCl2O2
Molecular weight269.90 g/mol
IUPAC name2-bromo-4,6-dichlorobenzoic acid
InChIKeyTYLORTSVHWJWAD-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Cl)C(=O)O)Br)Cl

Computed by PubChem (NCBI)