Products 887584-64-7
CAS 887584-64-7 appears in our catalog under these names: 2,3-Dichloro-6-bromobenzoic acid, 95%, 6-Bromo-2,3-dichlorobenzoic acid, 95+%, 6-Bromo-2,3-dichlorobenzoic acid, 2,3-Dichloro-6-bromobenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
6-bromo-2,3-dichlorobenzoic acid (CAS 887584-64-7) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 6-bromo-2,3-dichlorobenzoic acid. InChIKey: DULGWZUQJZGXKB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 6-bromo-2,3-dichlorobenzoic acid |
| InChIKey | DULGWZUQJZGXKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)Cl)C(=O)O)Br |
Computed by PubChem (NCBI)