CAS 15396-39-1 is the registry number for 2-Bromo-3,5-dichlorobenzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-bromo-3,5-dichlorobenzoic acid (CAS 15396-39-1) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 2-bromo-3,5-dichlorobenzoic acid. InChIKey: YGNYGLRBYWKIMH-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 2-bromo-3,5-dichlorobenzoic acid |
| InChIKey | YGNYGLRBYWKIMH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Br)Cl)Cl |
Computed by PubChem (NCBI)