cas: 651027-00-8 — see every product listed under this CAS number, including other names
4-Bromo-3,5-difluorobenzoic acid, 95% (CAS 651027-00-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F069434-1G |
| cas | 651027-00-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 10g | 320.74 Pln | |
| Fluorochem | 25g | 690.40 Pln | |
| Fluorochem | 100g | 2424.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-bromo-3,5-difluorobenzoic acid (CAS 651027-00-8) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 4-bromo-3,5-difluorobenzoic acid. InChIKey: NLLRAEQVOZOSBB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 4-bromo-3,5-difluorobenzoic acid |
| InChIKey | NLLRAEQVOZOSBB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Br)F)C(=O)O |
Computed by PubChem (NCBI)