cas: 1020717-99-0 — see every product listed under this CAS number, including other names
4-Bromo-5-fluoro-2-nitrobenzoic Acid, 98%, 98% (CAS 1020717-99-0) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1117HW-1kg |
| cas | 1020717-99-0 |
| size | 1kg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 4326.80 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 174.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-5-fluoro-2-nitrobenzoic acid (CAS 1020717-99-0) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 4-bromo-5-fluoro-2-nitrobenzoic acid. InChIKey: JZVCMOJSPCGLTC-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2-nitrobenzoic acid |
| InChIKey | JZVCMOJSPCGLTC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)