4-Bromo-5-fluoro-2-nitrobenzoic acid, 98%
cas: 1020717-99-0 — see every product listed under this CAS number, including other names
4-Bromo-5-fluoro-2-nitrobenzoic acid, 98% (CAS 1020717-99-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A474733-250mg |
| cas | 1020717-99-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 309.19 Pln | |
| Ambeed | 100g | 770.88 Pln | |
| Ambeed | 500g | 3535.44 Pln | |
| Ambeed | 1kg | 5615.81 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 184.40 Pln | |
| Chemat | 100g | 554.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-bromo-5-fluoro-2-nitrobenzoic acid (CAS 1020717-99-0) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 4-bromo-5-fluoro-2-nitrobenzoic acid. InChIKey: JZVCMOJSPCGLTC-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2-nitrobenzoic acid |
| InChIKey | JZVCMOJSPCGLTC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)