cas: 1020717-99-0 — see every product listed under this CAS number, including other names
4-Bromo-5-fluoro-2-nitrobenzoic acid 98% (CAS 1020717-99-0) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A474733-1000g |
| cas | 1020717-99-0 |
| size | 1000g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 5560.19 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 303.62 Pln | |
| Ambeed | 100g | 759.75 Pln | |
| Ambeed | 500g | 3502.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A474733 |
4-bromo-5-fluoro-2-nitrobenzoic acid (CAS 1020717-99-0) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 4-bromo-5-fluoro-2-nitrobenzoic acid. InChIKey: JZVCMOJSPCGLTC-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2-nitrobenzoic acid |
| InChIKey | JZVCMOJSPCGLTC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)