cas: 1879026-06-8 — see every product listed under this CAS number, including other names
4-Chloro-2,3-difluoro-5-methoxybenzaldehyde (CAS 1879026-06-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631660-1G |
| cas | 1879026-06-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4392.22 Pln | |
| Fluorochem | 5g | 13045.42 Pln |
| delivery time | 3-4 weeks |
|---|
4-chloro-2,3-difluoro-5-methoxybenzaldehyde (CAS 1879026-06-8) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 4-chloro-2,3-difluoro-5-methoxybenzaldehyde. InChIKey: MMVKNQVXCPGQLL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 4-chloro-2,3-difluoro-5-methoxybenzaldehyde |
| InChIKey | MMVKNQVXCPGQLL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C=O)F)F)Cl |
Computed by PubChem (NCBI)