cas: 916602-09-0 — see every product listed under this CAS number, including other names
METHYL L-2-(4-FLUOROPHENYL)GLYCINATE HYDROCHLORIDE, 97% (CAS 916602-09-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303305-250MG |
| cas | 916602-09-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 325.94 Pln | |
| Fluorochem | 5g | 955.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2S)-2-amino-2-(4-fluorophenyl)acetate;hydrochloride (CAS 916602-09-0) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: methyl (2S)-2-amino-2-(4-fluorophenyl)acetate;hydrochloride. InChIKey: JLGSKYIBZLQSFR-QRPNPIFTSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-(4-fluorophenyl)acetate;hydrochloride |
| InChIKey | JLGSKYIBZLQSFR-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)