cas: 1214334-98-1 — see every product listed under this CAS number, including other names
Methyl 4-chloro-2,3-difluorobenzoate (CAS 1214334-98-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631535-1G |
| cas | 1214334-98-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1705.67 Pln | |
| Fluorochem | 5g | 4975.35 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 4-chloro-2,3-difluorobenzoate (CAS 1214334-98-1) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: methyl 4-chloro-2,3-difluorobenzoate. InChIKey: LVPFZWHSCSDSKZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | methyl 4-chloro-2,3-difluorobenzoate |
| InChIKey | LVPFZWHSCSDSKZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Cl)F)F |
Computed by PubChem (NCBI)