Products 1261869-14-0
CAS 1261869-14-0 appears in our catalog under these names: Methyl 2-chloro-4,6-difluorobenzoate, 95%, Methyl 2-chloro-4,6-difluorobenzoate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg.
Methyl 2-chloro-4,6-difluorobenzoate (CAS 1261869-14-0) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: methyl 2-chloro-4,6-difluorobenzoate. InChIKey: AGTGSYGWBGMUSG-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | methyl 2-chloro-4,6-difluorobenzoate |
| InChIKey | AGTGSYGWBGMUSG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Cl)F)F |
Computed by PubChem (NCBI)