Products 1309980-95-7
CAS 1309980-95-7 appears in our catalog under these names: (6–Ethoxy–2，3–difluorophenyl)boronic acid, (6-Ethoxy-2,3-difluorophenyl)boronic acid, 97%, 2,3-Difluoro-6-ethoxyphenylboronic acid, 97%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
(6-ethoxy-2,3-difluorophenyl)boronic acid (CAS 1309980-95-7) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (6-ethoxy-2,3-difluorophenyl)boronic acid. InChIKey: KVSMPXUZSFLBMK-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (6-ethoxy-2,3-difluorophenyl)boronic acid |
| InChIKey | KVSMPXUZSFLBMK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)F)OCC)(O)O |
Computed by PubChem (NCBI)