Products 2765315-99-7
CAS 2765315-99-7 is the registry number for (3-(Difluoromethoxy)-5-methylphenyl)boronic acid, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
[3-(difluoromethoxy)-5-methylphenyl]boronic acid (CAS 2765315-99-7) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: [3-(difluoromethoxy)-5-methylphenyl]boronic acid. InChIKey: RORRUCLSOXKMKZ-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | [3-(difluoromethoxy)-5-methylphenyl]boronic acid |
| InChIKey | RORRUCLSOXKMKZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OC(F)F)C)(O)O |
Computed by PubChem (NCBI)