CAS 28314-83-2 appears in our catalog under these names: 3-Bromo-4,6-difluorobenzoic Acid, 5-Bromo-2,4-difluorobenzoic acid 97%, 5-Bromo-2,4-difluorobenzoic Acid, 98%, 98%, 5-Bromo-2,4-difluorobenzoic acid, 97%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100g, 50g, 250g.
5-bromo-2,4-difluorobenzoic acid (CAS 28314-83-2) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 5-bromo-2,4-difluorobenzoic acid. InChIKey: BLSMDXUAEFVYID-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 5-bromo-2,4-difluorobenzoic acid |
| InChIKey | BLSMDXUAEFVYID-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)F)C(=O)O |
Computed by PubChem (NCBI)