Products 33070-31-4
CAS 33070-31-4 appears in our catalog under these names: 5-Bromo-2,2-dichlorobenzo[d][1,3]dioxole, 97%, 97%, 5-Bromo-2,2-dichlorobenzo[d][1,3]dioxole, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-bromo-2,2-dichloro-1,3-benzodioxole (CAS 33070-31-4) is a chemical compound with the molecular formula C7H3BrCl2O2 and a molecular weight of 269.90 g/mol. IUPAC name: 5-bromo-2,2-dichloro-1,3-benzodioxole. InChIKey: RFAKPAPFJWMBHW-UHFFFAOYSA-N.
| Molecular formula | C7H3BrCl2O2 |
|---|---|
| Molecular weight | 269.90 g/mol |
| IUPAC name | 5-bromo-2,2-dichloro-1,3-benzodioxole |
| InChIKey | RFAKPAPFJWMBHW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC(O2)(Cl)Cl |
Computed by PubChem (NCBI)