CAS 958452-33-0 is the registry number for B-[3-(2,2-Difluoroethoxy)phenyl]boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[3-(2,2-difluoroethoxy)phenyl]boronic acid (CAS 958452-33-0) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: [3-(2,2-difluoroethoxy)phenyl]boronic acid. InChIKey: RPRWURPVNIXBNV-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | [3-(2,2-difluoroethoxy)phenyl]boronic acid |
| InChIKey | RPRWURPVNIXBNV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC(F)F)(O)O |
Computed by PubChem (NCBI)