(4-(2,2-Difluoroethoxy)Phenyl)Boronic Acid, ≥97%
cas: 958453-65-1 — see every product listed under this CAS number, including other names
(4-(2,2-Difluoroethoxy)Phenyl)Boronic Acid, ≥97% (CAS 958453-65-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJHA-100mg |
| cas | 958453-65-1 |
| size | 100mg |
| availability | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 250mg | 842.00 Pln | |
| Chemat | 1g | 1970.00 Pln | |
| Chemat | 5g | 4624.40 Pln | |
| Fluorochem | 100mg | 1086.09 Pln | |
| Fluorochem | 250mg | 1559.89 Pln | |
| Fluorochem | 1g | 3642.49 Pln | |
| Fluorochem | 5g | 8422.05 Pln |
properties
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
[4-(2,2-difluoroethoxy)phenyl]boronic acid (CAS 958453-65-1) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: [4-(2,2-difluoroethoxy)phenyl]boronic acid. InChIKey: ZSNRGSJVRBZBET-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | [4-(2,2-difluoroethoxy)phenyl]boronic acid |
| InChIKey | ZSNRGSJVRBZBET-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC(F)F)(O)O |
Computed by PubChem (NCBI)