Products 958453-65-1
CAS 958453-65-1 appears in our catalog under these names: (4-(2,2-Difluoroethoxy)phenyl)boronic acid, 95%, (4-(2,2-Difluoroethoxy)Phenyl)Boronic Acid, ≥97%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
[4-(2,2-difluoroethoxy)phenyl]boronic acid (CAS 958453-65-1) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: [4-(2,2-difluoroethoxy)phenyl]boronic acid. InChIKey: ZSNRGSJVRBZBET-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | [4-(2,2-difluoroethoxy)phenyl]boronic acid |
| InChIKey | ZSNRGSJVRBZBET-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC(F)F)(O)O |
Computed by PubChem (NCBI)