4,5-Difluoro-2-nitrobenzoic acid, 97%
cas: 20372-63-8 — see every product listed under this CAS number, including other names
4,5-Difluoro-2-nitrobenzoic acid, 97% (CAS 20372-63-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 500g, 1kg, 5g, 10g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F045029-1G |
| cas | 20372-63-8 |
| size | 1g |
| availability | In Stock UK |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 25g | 143.72 Pln | |
| Fluorochem | 100g | 331.15 Pln | |
| Fluorochem | 500g | 1362.04 Pln | |
| Fluorochem | 1kg | 2465.82 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1316.00 Pln | |
| Ambeed | 1kg | 2395.12 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
4,5-difluoro-2-nitrobenzoic acid (CAS 20372-63-8) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 4,5-difluoro-2-nitrobenzoic acid. InChIKey: HGGRAOYTQNFGGN-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 4,5-difluoro-2-nitrobenzoic acid |
| InChIKey | HGGRAOYTQNFGGN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)